C7H14N2S — CID 130993898
(6S,8aR)-6-methyl-3,5,6,7,8,8a-hexahydro-1H-[1,3]thiazolo[3,4-a]pyrazine (PubChem CID 130993898) has the molecular formula C7H14N2S and a molecular weight of 158.27 g/mol. Its IUPAC name is (6S,8aR)-6-methyl-3,5,6,7,8,8a-hexahydro-1H-[1,3]thiazolo[3,4-a]pyrazine.
| Compound Name | (6S,8aR)-6-methyl-3,5,6,7,8,8a-hexahydro-1H-[1,3]thiazolo[3,4-a]pyrazine |
|---|---|
| PubChem CID | 130993898 |
| Molecular Formula | C7H14N2S |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (6S,8aR)-6-methyl-3,5,6,7,8,8a-hexahydro-1H-[1,3]thiazolo[3,4-a]pyrazine |
| SMILES | C[C@H]1CN2CSC[C@H]2CN1 |
| InChI | InChI=1S/C7H14N2S/c1-6-3-9-5-10-4-7(9)2-8-6/h6-8H,2-5H2,1H3/t6-,7+/m0/s1 |
| InChIKey | YSBKEJZVWSWHMV-NKWVEPMBSA-N |
| XLogP | 0.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |