C19H18N2 — CID 13078350
9-phenyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene (PubChem CID 13078350) has the molecular formula C19H18N2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 9-phenyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene.
| Compound Name | 9-phenyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene |
|---|---|
| PubChem CID | 13078350 |
| Molecular Formula | C19H18N2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 9-phenyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene |
| SMILES | c1ccc(-n2c3c(c4ccccc42)C2CCC(C3)N2)cc1 |
| InChI | InChI=1S/C19H18N2/c1-2-6-14(7-3-1)21-17-9-5-4-8-15(17)19-16-11-10-13(20-16)12-18(19)21/h1-9,13,16,20H,10-12H2 |
| InChIKey | MIZKDYBHLUZOTA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |