About (1S,4R)-N,N-dimethylbicyclo[2.1.0]pentan-5-amine
(1S,4R)-N,N-dimethylbicyclo[2.1.0]pentan-5-amine (PubChem CID 130806116) has the molecular formula C7H13N
and a molecular weight of 111.19 g/mol. Its IUPAC name is (1S,4R)-N,N-dimethylbicyclo[2.1.0]pentan-5-amine.
Analyze (1S,4R)-N,N-dimethylbicyclo[2.1.0]pentan-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,4R)-N,N-dimethylbicyclo[2.1.0]pentan-5-amine?
The IUPAC name of (1S,4R)-N,N-dimethylbicyclo[2.1.0]pentan-5-amine (CID 130806116) is (1S,4R)-N,N-dimethylbicyclo[2.1.0]pentan-5-amine.
What is the SMILES notation for (1S,4R)-N,N-dimethylbicyclo[2.1.0]pentan-5-amine?
The canonical SMILES for (1S,4R)-N,N-dimethylbicyclo[2.1.0]pentan-5-amine is CN(C)C1[C@H]2CC[C@@H]12.
What is the InChIKey of (1S,4R)-N,N-dimethylbicyclo[2.1.0]pentan-5-amine?
The InChIKey is FLVFCJFKVXQQJX-MEKDEQNOSA-N. The full InChI is InChI=1S/C7H13N/c1-8(2)7-5-3-4-6(5)7/h5-7H,3-4H2,1-2H3/t5-,6+,7?.
What are the key properties of (1S,4R)-N,N-dimethylbicyclo[2.1.0]pentan-5-amine?
(1S,4R)-N,N-dimethylbicyclo[2.1.0]pentan-5-amine has a molecular weight of 111.19 g/mol, XLogP of 0.96, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4R)-N,N-dimethylbicyclo[2.1.0]pentan-5-amine is sourced from PubChem (CID 130806116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).