C10H18N2O2-2 — CID 163482879
7-N,8-N-dimethyl-7-N,8-N-dioxidobicyclo[4.2.0]octane-7,8-diamine (PubChem CID 163482879) has the molecular formula C10H18N2O2-2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 7-N,8-N-dimethyl-7-N,8-N-dioxidobicyclo[4.2.0]octane-7,8-diamine.
| Compound Name | 7-N,8-N-dimethyl-7-N,8-N-dioxidobicyclo[4.2.0]octane-7,8-diamine |
|---|---|
| PubChem CID | 163482879 |
| Molecular Formula | C10H18N2O2-2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 7-N,8-N-dimethyl-7-N,8-N-dioxidobicyclo[4.2.0]octane-7,8-diamine |
| SMILES | CN([O-])C1C2CCCCC2C1N(C)[O-] |
| InChI | InChI=1S/C10H18N2O2/c1-11(13)9-7-5-3-4-6-8(7)10(9)12(2)14/h7-10H,3-6H2,1-2H3/q-2 |
| InChIKey | AZACAZFJZSLITE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|