C9H18N3O3-3 — CID 163645688
1-N,3-N,5-N-trimethyl-1-N,3-N,5-N-trioxidocyclohexane-1,3,5-triamine (PubChem CID 163645688) has the molecular formula C9H18N3O3-3 and a molecular weight of 216.26 g/mol. Its IUPAC name is 1-N,3-N,5-N-trimethyl-1-N,3-N,5-N-trioxidocyclohexane-1,3,5-triamine.
| Compound Name | 1-N,3-N,5-N-trimethyl-1-N,3-N,5-N-trioxidocyclohexane-1,3,5-triamine |
|---|---|
| PubChem CID | 163645688 |
| Molecular Formula | C9H18N3O3-3 |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 1-N,3-N,5-N-trimethyl-1-N,3-N,5-N-trioxidocyclohexane-1,3,5-triamine |
| SMILES | CN([O-])C1CC(N(C)[O-])CC(N(C)[O-])C1 |
| InChI | InChI=1S/C9H18N3O3/c1-10(13)7-4-8(11(2)14)6-9(5-7)12(3)15/h7-9H,4-6H2,1-3H3/q-3 |
| InChIKey | CAZDDLYMSHTNRY-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|