C7H15ClN2O4 — CID 134976868
[2,3-bis(dimethylamino)cyclopropyl] perchlorate (PubChem CID 134976868) has the molecular formula C7H15ClN2O4 and a molecular weight of 226.66 g/mol. Its IUPAC name is [2,3-bis(dimethylamino)cyclopropyl] perchlorate.
| Compound Name | [2,3-bis(dimethylamino)cyclopropyl] perchlorate |
|---|---|
| PubChem CID | 134976868 |
| Molecular Formula | C7H15ClN2O4 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | [2,3-bis(dimethylamino)cyclopropyl] perchlorate |
| SMILES | CN(C)C1C(O[Cl+3]([O-])([O-])[O-])C1N(C)C |
| InChI | InChI=1S/C7H15ClN2O4/c1-9(2)5-6(10(3)4)7(5)14-8(11,12)13/h5-7H,1-4H3 |
| InChIKey | OPHOUHHEPBSSGI-UHFFFAOYSA-N |
| XLogP | -3.86 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | -3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |