C16H27NO — CID 119079782
(1S,2S,3R,4R)-3-[(1R,2S,3R,4S)-3-(dimethylamino)-2-bicyclo[2.2.1]heptanyl]bicyclo[2.2.1]heptan-2-ol (PubChem CID 119079782) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-[(1R,2S,3R,4S)-3-(dimethylamino)-2-bicyclo[2.2.1]heptanyl]bicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1S,2S,3R,4R)-3-[(1R,2S,3R,4S)-3-(dimethylamino)-2-bicyclo[2.2.1]heptanyl]bicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 119079782 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (1S,2S,3R,4R)-3-[(1R,2S,3R,4S)-3-(dimethylamino)-2-bicyclo[2.2.1]heptanyl]bicyclo[2.2.1]heptan-2-ol |
| SMILES | CN(C)[C@@H]1[C@H]2CC[C@H](C2)[C@H]1[C@H]1[C@@H]2CC[C@@H](C2)[C@@H]1O |
| InChI | InChI=1S/C16H27NO/c1-17(2)15-11-5-3-9(7-11)13(15)14-10-4-6-12(8-10)16(14)18/h9-16,18H,3-8H2,1-2H3/t9-,10-,11+,12+,13+,14-,15-,16+/m1/s1 |
| InChIKey | JLDXGWBOANAMML-FZLKWGRZSA-N |
| XLogP | 2.37 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |