C15H25NO2 — CID 163643551
4-cyclohexyl-4-azatricyclo[5.2.1.02,6]decane-3,5-diol (PubChem CID 163643551) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 4-cyclohexyl-4-azatricyclo[5.2.1.02,6]decane-3,5-diol.
| Compound Name | 4-cyclohexyl-4-azatricyclo[5.2.1.02,6]decane-3,5-diol |
|---|---|
| PubChem CID | 163643551 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 4-cyclohexyl-4-azatricyclo[5.2.1.02,6]decane-3,5-diol |
| SMILES | OC1C2C3CCC(C3)C2C(O)N1C1CCCCC1 |
| InChI | InChI=1S/C15H25NO2/c17-14-12-9-6-7-10(8-9)13(12)15(18)16(14)11-4-2-1-3-5-11/h9-15,17-18H,1-8H2 |
| InChIKey | IGIRIASVFMJDRI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |