C10F10 — CID 13082395
3-(difluoromethylidene)-1,1,2,2,4,5,6,7-octafluoroindene (PubChem CID 13082395) has the molecular formula C10F10 and a molecular weight of 310.09 g/mol. Its IUPAC name is 3-(difluoromethylidene)-1,1,2,2,4,5,6,7-octafluoroindene.
| Compound Name | 3-(difluoromethylidene)-1,1,2,2,4,5,6,7-octafluoroindene |
|---|---|
| PubChem CID | 13082395 |
| Molecular Formula | C10F10 |
| Molecular Weight | 310.09 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | 3-(difluoromethylidene)-1,1,2,2,4,5,6,7-octafluoroindene |
| SMILES | FC(F)=C1c2c(F)c(F)c(F)c(F)c2C(F)(F)C1(F)F |
| InChI | InChI=1S/C10F10/c11-4-1-2(5(12)7(14)6(4)13)9(17,18)10(19,20)3(1)8(15)16 |
| InChIKey | BGDLBQCODKTRKG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.09 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|