C5H5ClN2O2S — CID 130831213
4-chloro-N-methoxy-1,3-thiazole-2-carboxamide (PubChem CID 130831213) has the molecular formula C5H5ClN2O2S and a molecular weight of 192.63 g/mol. Its IUPAC name is 4-chloro-N-methoxy-1,3-thiazole-2-carboxamide.
| Compound Name | 4-chloro-N-methoxy-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 130831213 |
| Molecular Formula | C5H5ClN2O2S |
| Molecular Weight | 192.63 g/mol |
| Exact Mass | 191.98 |
| IUPAC Name | 4-chloro-N-methoxy-1,3-thiazole-2-carboxamide |
| SMILES | CONC(=O)c1nc(Cl)cs1 |
| InChI | InChI=1S/C5H5ClN2O2S/c1-10-8-4(9)5-7-3(6)2-11-5/h2H,1H3,(H,8,9) |
| InChIKey | FJSDAISIDTWKFQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.63 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|