C6H8N2O2S2 — CID 89470086
N-methoxy-2-methylsulfanyl-1,3-thiazole-4-carboxamide (PubChem CID 89470086) has the molecular formula C6H8N2O2S2 and a molecular weight of 204.28 g/mol. Its IUPAC name is N-methoxy-2-methylsulfanyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-methoxy-2-methylsulfanyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 89470086 |
| Molecular Formula | C6H8N2O2S2 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.00 |
| IUPAC Name | N-methoxy-2-methylsulfanyl-1,3-thiazole-4-carboxamide |
| SMILES | CONC(=O)c1csc(SC)n1 |
| InChI | InChI=1S/C6H8N2O2S2/c1-10-8-5(9)4-3-12-6(7-4)11-2/h3H,1-2H3,(H,8,9) |
| InChIKey | ZLCSKHSAYOGWKI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|