About tricyclo[3.3.2.01,5]decane-3,7-dione
tricyclo[3.3.2.01,5]decane-3,7-dione (PubChem CID 130831623) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is tricyclo[3.3.2.01,5]decane-3,7-dione.
Molecular Properties
| Compound Name | tricyclo[3.3.2.01,5]decane-3,7-dione |
| PubChem CID | 130831623 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | tricyclo[3.3.2.01,5]decane-3,7-dione |
| SMILES | O=C1CC23CCC2(C1)CC(=O)C3 |
| InChI | InChI=1S/C10H12O2/c11-7-3-9-1-2-10(9,5-7)6-8(12)4-9/h1-6H2 |
| InChIKey | QPJFXUZDZXCCKM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tricyclo[3.3.2.01,5]decane-3,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[3.3.2.01,5]decane-3,7-dione?
The IUPAC name of tricyclo[3.3.2.01,5]decane-3,7-dione (CID 130831623) is tricyclo[3.3.2.01,5]decane-3,7-dione.
What is the SMILES notation for tricyclo[3.3.2.01,5]decane-3,7-dione?
The canonical SMILES for tricyclo[3.3.2.01,5]decane-3,7-dione is O=C1CC23CCC2(C1)CC(=O)C3.
What is the InChIKey of tricyclo[3.3.2.01,5]decane-3,7-dione?
The InChIKey is QPJFXUZDZXCCKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c11-7-3-9-1-2-10(9,5-7)6-8(12)4-9/h1-6H2.
What are the key properties of tricyclo[3.3.2.01,5]decane-3,7-dione?
tricyclo[3.3.2.01,5]decane-3,7-dione has a molecular weight of 164.20 g/mol, XLogP of 1.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[3.3.2.01,5]decane-3,7-dione is sourced from PubChem (CID 130831623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).