About tricyclo[10.3.3.01,12]octadec-6-yne-14,17-dione
tricyclo[10.3.3.01,12]octadec-6-yne-14,17-dione (PubChem CID 10333453) has the molecular formula C18H24O2
and a molecular weight of 272.39 g/mol. Its IUPAC name is tricyclo[10.3.3.01,12]octadec-6-yne-14,17-dione.
Molecular Properties
| Compound Name | tricyclo[10.3.3.01,12]octadec-6-yne-14,17-dione |
| PubChem CID | 10333453 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | tricyclo[10.3.3.01,12]octadec-6-yne-14,17-dione |
| SMILES | O=C1CC23CCCCC#CCCCCC2(C1)CC(=O)C3 |
| InChI | InChI=1S/C18H24O2/c19-15-11-17-9-7-5-3-1-2-4-6-8-10-18(17,13-15)14-16(20)12-17/h3-14H2 |
| InChIKey | NGWWKMNWXCNOAG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tricyclo[10.3.3.01,12]octadec-6-yne-14,17-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[10.3.3.01,12]octadec-6-yne-14,17-dione?
The IUPAC name of tricyclo[10.3.3.01,12]octadec-6-yne-14,17-dione (CID 10333453) is tricyclo[10.3.3.01,12]octadec-6-yne-14,17-dione.
What is the SMILES notation for tricyclo[10.3.3.01,12]octadec-6-yne-14,17-dione?
The canonical SMILES for tricyclo[10.3.3.01,12]octadec-6-yne-14,17-dione is O=C1CC23CCCCC#CCCCCC2(C1)CC(=O)C3.
What is the InChIKey of tricyclo[10.3.3.01,12]octadec-6-yne-14,17-dione?
The InChIKey is NGWWKMNWXCNOAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24O2/c19-15-11-17-9-7-5-3-1-2-4-6-8-10-18(17,13-15)14-16(20)12-17/h3-14H2.
What are the key properties of tricyclo[10.3.3.01,12]octadec-6-yne-14,17-dione?
tricyclo[10.3.3.01,12]octadec-6-yne-14,17-dione has a molecular weight of 272.39 g/mol, XLogP of 3.82, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[10.3.3.01,12]octadec-6-yne-14,17-dione is sourced from PubChem (CID 10333453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).