C6H10BrCl — CID 130836761
trans-(1R,3R)-1-bromo-3-chlorocyclohexane (PubChem CID 130836761) has the molecular formula C6H10BrCl and a molecular weight of 197.50 g/mol. Its IUPAC name is trans-(1R,3R)-1-bromo-3-chlorocyclohexane.
| Compound Name | trans-(1R,3R)-1-bromo-3-chlorocyclohexane |
|---|---|
| PubChem CID | 130836761 |
| Molecular Formula | C6H10BrCl |
| Molecular Weight | 197.50 g/mol |
| Exact Mass | 195.97 |
| IUPAC Name | trans-(1R,3R)-1-bromo-3-chlorocyclohexane |
| SMILES | Cl[C@@H]1CCC[C@@H](Br)C1 |
| InChI | InChI=1S/C6H10BrCl/c7-5-2-1-3-6(8)4-5/h5-6H,1-4H2/t5-,6-/m1/s1 |
| InChIKey | GAEPCRDAXVBBNZ-PHDIDXHHSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|