C12H18Br6 — CID 174618529
1,2,4,5,7,9-hexabromocyclododecane (PubChem CID 174618529) has the molecular formula C12H18Br6 and a molecular weight of 641.70 g/mol. Its IUPAC name is 1,2,4,5,7,9-hexabromocyclododecane.
| Compound Name | 1,2,4,5,7,9-hexabromocyclododecane |
|---|---|
| PubChem CID | 174618529 |
| Molecular Formula | C12H18Br6 |
| Molecular Weight | 641.70 g/mol |
| Exact Mass | 635.65 |
| IUPAC Name | 1,2,4,5,7,9-hexabromocyclododecane |
| SMILES | BrC1CCCC(Br)C(Br)CC(Br)C(Br)CC(Br)C1 |
| InChI | InChI=1S/C12H18Br6/c13-7-2-1-3-9(15)11(17)6-12(18)10(16)5-8(14)4-7/h7-12H,1-6H2 |
| InChIKey | AMOUCBZHNCAHQG-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.70 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|