About 3-bromocyclohexane-1-carboxylic acid;indigane
3-bromocyclohexane-1-carboxylic acid;indigane (PubChem CID 173230710) has the molecular formula C7H14BrInO2
and a molecular weight of 324.91 g/mol. Its IUPAC name is 3-bromocyclohexane-1-carboxylic acid;indigane.
Molecular Properties
| Compound Name | 3-bromocyclohexane-1-carboxylic acid;indigane |
| PubChem CID | 173230710 |
| Molecular Formula | C7H14BrInO2 |
| Molecular Weight | 324.91 g/mol |
| Exact Mass | 323.92 |
| IUPAC Name | 3-bromocyclohexane-1-carboxylic acid;indigane |
| SMILES | O=C(O)C1CCCC(Br)C1.[InH3] |
| InChI | InChI=1S/C7H11BrO2.In.3H/c8-6-3-1-2-5(4-6)7(9)10;;;;/h5-6H,1-4H2,(H,9,10);;;; |
| InChIKey | JUVHUZAFVYOHRW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.91 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromocyclohexane-1-carboxylic acid;indigane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromocyclohexane-1-carboxylic acid;indigane?
The IUPAC name of 3-bromocyclohexane-1-carboxylic acid;indigane (CID 173230710) is 3-bromocyclohexane-1-carboxylic acid;indigane.
What is the SMILES notation for 3-bromocyclohexane-1-carboxylic acid;indigane?
The canonical SMILES for 3-bromocyclohexane-1-carboxylic acid;indigane is O=C(O)C1CCCC(Br)C1.[InH3].
What is the InChIKey of 3-bromocyclohexane-1-carboxylic acid;indigane?
The InChIKey is JUVHUZAFVYOHRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11BrO2.In.3H/c8-6-3-1-2-5(4-6)7(9)10;;;;/h5-6H,1-4H2,(H,9,10);;;;.
What are the key properties of 3-bromocyclohexane-1-carboxylic acid;indigane?
3-bromocyclohexane-1-carboxylic acid;indigane has a molecular weight of 324.91 g/mol, XLogP of 0.84, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromocyclohexane-1-carboxylic acid;indigane is sourced from PubChem (CID 173230710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).