C7H13N3S — CID 130839885
1-cyanopropyl N,N'-dimethylcarbamimidothioate (PubChem CID 130839885) has the molecular formula C7H13N3S and a molecular weight of 171.27 g/mol. Its IUPAC name is 1-cyanopropyl N,N'-dimethylcarbamimidothioate.
| Compound Name | 1-cyanopropyl N,N'-dimethylcarbamimidothioate |
|---|---|
| PubChem CID | 130839885 |
| Molecular Formula | C7H13N3S |
| Molecular Weight | 171.27 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 1-cyanopropyl N,N'-dimethylcarbamimidothioate |
| SMILES | CCC(C#N)S/C(=N/C)NC |
| InChI | InChI=1S/C7H13N3S/c1-4-6(5-8)11-7(9-2)10-3/h6H,4H2,1-3H3,(H,9,10) |
| InChIKey | DYIVAIJNOOCTIB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|