C8H18N2S — CID 131224536
pentan-2-yl N,N'-dimethylcarbamimidothioate (PubChem CID 131224536) has the molecular formula C8H18N2S and a molecular weight of 174.31 g/mol. Its IUPAC name is pentan-2-yl N,N'-dimethylcarbamimidothioate.
| Compound Name | pentan-2-yl N,N'-dimethylcarbamimidothioate |
|---|---|
| PubChem CID | 131224536 |
| Molecular Formula | C8H18N2S |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | pentan-2-yl N,N'-dimethylcarbamimidothioate |
| SMILES | CCCC(C)S/C(=N/C)NC |
| InChI | InChI=1S/C8H18N2S/c1-5-6-7(2)11-8(9-3)10-4/h7H,5-6H2,1-4H3,(H,9,10) |
| InChIKey | JBGJBNIIQQZCLL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|