About S-pentan-2-ylthiohydroxylamine;urea
S-pentan-2-ylthiohydroxylamine;urea (PubChem CID 174856367) has the molecular formula C6H17N3OS
and a molecular weight of 179.29 g/mol. Its IUPAC name is S-pentan-2-ylthiohydroxylamine;urea.
Molecular Properties
| Compound Name | S-pentan-2-ylthiohydroxylamine;urea |
| PubChem CID | 174856367 |
| Molecular Formula | C6H17N3OS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | S-pentan-2-ylthiohydroxylamine;urea |
| SMILES | CCCC(C)SN.NC(N)=O |
| InChI | InChI=1S/C5H13NS.CH4N2O/c1-3-4-5(2)7-6;2-1(3)4/h5H,3-4,6H2,1-2H3;(H4,2,3,4) |
| InChIKey | NTVOSYFHBQHDCX-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze S-pentan-2-ylthiohydroxylamine;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-pentan-2-ylthiohydroxylamine;urea?
The IUPAC name of S-pentan-2-ylthiohydroxylamine;urea (CID 174856367) is S-pentan-2-ylthiohydroxylamine;urea.
What is the SMILES notation for S-pentan-2-ylthiohydroxylamine;urea?
The canonical SMILES for S-pentan-2-ylthiohydroxylamine;urea is CCCC(C)SN.NC(N)=O.
What is the InChIKey of S-pentan-2-ylthiohydroxylamine;urea?
The InChIKey is NTVOSYFHBQHDCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NS.CH4N2O/c1-3-4-5(2)7-6;2-1(3)4/h5H,3-4,6H2,1-2H3;(H4,2,3,4).
What are the key properties of S-pentan-2-ylthiohydroxylamine;urea?
S-pentan-2-ylthiohydroxylamine;urea has a molecular weight of 179.29 g/mol, XLogP of 0.81, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-pentan-2-ylthiohydroxylamine;urea is sourced from PubChem (CID 174856367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).