C7H16N2OS — CID 131224543
3-hydroxybutyl N,N'-dimethylcarbamimidothioate (PubChem CID 131224543) has the molecular formula C7H16N2OS and a molecular weight of 176.28 g/mol. Its IUPAC name is 3-hydroxybutyl N,N'-dimethylcarbamimidothioate.
| Compound Name | 3-hydroxybutyl N,N'-dimethylcarbamimidothioate |
|---|---|
| PubChem CID | 131224543 |
| Molecular Formula | C7H16N2OS |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 3-hydroxybutyl N,N'-dimethylcarbamimidothioate |
| SMILES | C/N=C(\NC)SCCC(C)O |
| InChI | InChI=1S/C7H16N2OS/c1-6(10)4-5-11-7(8-2)9-3/h6,10H,4-5H2,1-3H3,(H,8,9) |
| InChIKey | ZUYPTKMRTSZUFK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|