C9H15N3OS — CID 2444498
(3,5-dimethyl-1,2-oxazol-4-yl)methyl N,N'-dimethylcarbamimidothioate (PubChem CID 2444498) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)methyl N,N'-dimethylcarbamimidothioate.
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl N,N'-dimethylcarbamimidothioate |
|---|---|
| PubChem CID | 2444498 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl N,N'-dimethylcarbamimidothioate |
| SMILES | C/N=C(\NC)SCc1c(C)noc1C |
| InChI | InChI=1S/C9H15N3OS/c1-6-8(7(2)13-12-6)5-14-9(10-3)11-4/h5H2,1-4H3,(H,10,11) |
| InChIKey | ZHDJZVDXMBDJRZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|