C16H19ClN2S2 — CID 13084411
1-[[2-[2-(4-chlorophenyl)ethyl]-1,3-dithian-2-yl]methyl]imidazole (PubChem CID 13084411) has the molecular formula C16H19ClN2S2 and a molecular weight of 338.93 g/mol. Its IUPAC name is 1-[[2-[2-(4-chlorophenyl)ethyl]-1,3-dithian-2-yl]methyl]imidazole.
| Compound Name | 1-[[2-[2-(4-chlorophenyl)ethyl]-1,3-dithian-2-yl]methyl]imidazole |
|---|---|
| PubChem CID | 13084411 |
| Molecular Formula | C16H19ClN2S2 |
| Molecular Weight | 338.93 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 1-[[2-[2-(4-chlorophenyl)ethyl]-1,3-dithian-2-yl]methyl]imidazole |
| SMILES | Clc1ccc(CCC2(Cn3ccnc3)SCCCS2)cc1 |
| InChI | InChI=1S/C16H19ClN2S2/c17-15-4-2-14(3-5-15)6-7-16(20-10-1-11-21-16)12-19-9-8-18-13-19/h2-5,8-9,13H,1,6-7,10-12H2 |
| InChIKey | PNEQNEOFTMQGMX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.93 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |