C17H22N2S2 — CID 20518793
1-[[2-(3-phenylpropyl)-1,3-dithian-2-yl]methyl]imidazole (PubChem CID 20518793) has the molecular formula C17H22N2S2 and a molecular weight of 318.51 g/mol. Its IUPAC name is 1-[[2-(3-phenylpropyl)-1,3-dithian-2-yl]methyl]imidazole.
| Compound Name | 1-[[2-(3-phenylpropyl)-1,3-dithian-2-yl]methyl]imidazole |
|---|---|
| PubChem CID | 20518793 |
| Molecular Formula | C17H22N2S2 |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-[[2-(3-phenylpropyl)-1,3-dithian-2-yl]methyl]imidazole |
| SMILES | c1ccc(CCCC2(Cn3ccnc3)SCCCS2)cc1 |
| InChI | InChI=1S/C17H22N2S2/c1-2-6-16(7-3-1)8-4-9-17(20-12-5-13-21-17)14-19-11-10-18-15-19/h1-3,6-7,10-11,15H,4-5,8-9,12-14H2 |
| InChIKey | GTDUSTUAVAWIMA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |