C16H20N2S2 — CID 20518699
1-[[2-(3-phenylpropyl)-1,3-dithiolan-2-yl]methyl]imidazole (PubChem CID 20518699) has the molecular formula C16H20N2S2 and a molecular weight of 304.48 g/mol. Its IUPAC name is 1-[[2-(3-phenylpropyl)-1,3-dithiolan-2-yl]methyl]imidazole.
| Compound Name | 1-[[2-(3-phenylpropyl)-1,3-dithiolan-2-yl]methyl]imidazole |
|---|---|
| PubChem CID | 20518699 |
| Molecular Formula | C16H20N2S2 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 1-[[2-(3-phenylpropyl)-1,3-dithiolan-2-yl]methyl]imidazole |
| SMILES | c1ccc(CCCC2(Cn3ccnc3)SCCS2)cc1 |
| InChI | InChI=1S/C16H20N2S2/c1-2-5-15(6-3-1)7-4-8-16(19-11-12-20-16)13-18-10-9-17-14-18/h1-3,5-6,9-10,14H,4,7-8,11-13H2 |
| InChIKey | ZJWYPJZMTASYJU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |