C17H22N2S2 — CID 20518457
1-[[4-methyl-2-(2-phenylethyl)-1,3-dithian-2-yl]methyl]imidazole (PubChem CID 20518457) has the molecular formula C17H22N2S2 and a molecular weight of 318.51 g/mol. Its IUPAC name is 1-[[4-methyl-2-(2-phenylethyl)-1,3-dithian-2-yl]methyl]imidazole.
| Compound Name | 1-[[4-methyl-2-(2-phenylethyl)-1,3-dithian-2-yl]methyl]imidazole |
|---|---|
| PubChem CID | 20518457 |
| Molecular Formula | C17H22N2S2 |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-[[4-methyl-2-(2-phenylethyl)-1,3-dithian-2-yl]methyl]imidazole |
| SMILES | CC1CCSC(CCc2ccccc2)(Cn2ccnc2)S1 |
| InChI | InChI=1S/C17H22N2S2/c1-15-8-12-20-17(21-15,13-19-11-10-18-14-19)9-7-16-5-3-2-4-6-16/h2-6,10-11,14-15H,7-9,12-13H2,1H3 |
| InChIKey | USHSIWNTBDNWJB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |