C16H22 — CID 13085038
1,2,4,5,6,6,7-heptamethylindene (PubChem CID 13085038) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 1,2,4,5,6,6,7-heptamethylindene.
| Compound Name | 1,2,4,5,6,6,7-heptamethylindene |
|---|---|
| PubChem CID | 13085038 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1,2,4,5,6,6,7-heptamethylindene |
| SMILES | CC1=C(C)C2=C(C)C(C)(C)C(C)=C(C)C2=C1 |
| InChI | InChI=1S/C16H22/c1-9-8-14-11(3)12(4)16(6,7)13(5)15(14)10(9)2/h8H,1-7H3 |
| InChIKey | NJPNGBKKKRAOHK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |