C15H24 — CID 160680879
1,2,3,4,5,6,7,7-octamethylcyclohepta-1,3,5-triene (PubChem CID 160680879) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,7-octamethylcyclohepta-1,3,5-triene.
| Compound Name | 1,2,3,4,5,6,7,7-octamethylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 160680879 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 1,2,3,4,5,6,7,7-octamethylcyclohepta-1,3,5-triene |
| SMILES | CC1=C(C)C(C)=C(C)C(C)(C)C(C)=C1C |
| InChI | InChI=1S/C15H24/c1-9-10(2)12(4)14(6)15(7,8)13(5)11(9)3/h1-8H3 |
| InChIKey | JRXACBZFSGIUKD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |