C23H34 — CID 91243090
1,2,3,5,5-pentamethyl-4-[1-(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)prop-1-enyl]cyclopenta-1,3-diene (PubChem CID 91243090) has the molecular formula C23H34 and a molecular weight of 310.53 g/mol. Its IUPAC name is 1,2,3,5,5-pentamethyl-4-[1-(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)prop-1-enyl]cyclopenta-1,3-diene.
| Compound Name | 1,2,3,5,5-pentamethyl-4-[1-(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)prop-1-enyl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 91243090 |
| Molecular Formula | C23H34 |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | 1,2,3,5,5-pentamethyl-4-[1-(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)prop-1-enyl]cyclopenta-1,3-diene |
| SMILES | CC=C(C1=C(C)C(C)=C(C)C1(C)C)C1=C(C)C(C)=C(C)C1(C)C |
| InChI | InChI=1S/C23H34/c1-12-19(20-15(4)13(2)17(6)22(20,8)9)21-16(5)14(3)18(7)23(21,10)11/h12H,1-11H3 |
| InChIKey | MROKBKNQHOXAFF-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |