C12H20O — CID 121015071
2,3,4,5,6,6-hexamethylcyclohexa-2,4-dien-1-ol (PubChem CID 121015071) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is 2,3,4,5,6,6-hexamethylcyclohexa-2,4-dien-1-ol.
| Compound Name | 2,3,4,5,6,6-hexamethylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 121015071 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 2,3,4,5,6,6-hexamethylcyclohexa-2,4-dien-1-ol |
| SMILES | CC1=C(C)C(O)C(C)(C)C(C)=C1C |
| InChI | InChI=1S/C12H20O/c1-7-8(2)10(4)12(5,6)11(13)9(7)3/h11,13H,1-6H3 |
| InChIKey | AXLHRJQZCVPXPN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |