C11H14N2 — CID 130870041
N-[(4,6-dimethyl-3-pyridinyl)methyl]prop-2-yn-1-amine (PubChem CID 130870041) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is N-[(4,6-dimethyl-3-pyridinyl)methyl]prop-2-yn-1-amine.
| Compound Name | N-[(4,6-dimethyl-3-pyridinyl)methyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 130870041 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | N-[(4,6-dimethyl-3-pyridinyl)methyl]prop-2-yn-1-amine |
| SMILES | C#CCNCc1cnc(C)cc1C |
| InChI | InChI=1S/C11H14N2/c1-4-5-12-7-11-8-13-10(3)6-9(11)2/h1,6,8,12H,5,7H2,2-3H3 |
| InChIKey | ZFIGMHMINZXWMZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|