C8H11Br2N — CID 155977820
5-(bromomethyl)-2,4-dimethylpyridine;hydrobromide (PubChem CID 155977820) has the molecular formula C8H11Br2N and a molecular weight of 280.99 g/mol. Its IUPAC name is 5-(bromomethyl)-2,4-dimethylpyridine;hydrobromide.
| Compound Name | 5-(bromomethyl)-2,4-dimethylpyridine;hydrobromide |
|---|---|
| PubChem CID | 155977820 |
| Molecular Formula | C8H11Br2N |
| Molecular Weight | 280.99 g/mol |
| Exact Mass | 278.93 |
| IUPAC Name | 5-(bromomethyl)-2,4-dimethylpyridine;hydrobromide |
| SMILES | Br.Cc1cc(C)c(CBr)cn1 |
| InChI | InChI=1S/C8H10BrN.BrH/c1-6-3-7(2)10-5-8(6)4-9;/h3,5H,4H2,1-2H3;1H |
| InChIKey | CJUSOXSZMCWXNI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.99 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|