C8H5Br2NS — CID 130870284
2,5-dibromo-1-benzothiophen-7-amine (PubChem CID 130870284) has the molecular formula C8H5Br2NS and a molecular weight of 307.01 g/mol. Its IUPAC name is 2,5-dibromo-1-benzothiophen-7-amine.
| Compound Name | 2,5-dibromo-1-benzothiophen-7-amine |
|---|---|
| PubChem CID | 130870284 |
| Molecular Formula | C8H5Br2NS |
| Molecular Weight | 307.01 g/mol |
| Exact Mass | 304.85 |
| IUPAC Name | 2,5-dibromo-1-benzothiophen-7-amine |
| SMILES | Nc1cc(Br)cc2cc(Br)sc12 |
| InChI | InChI=1S/C8H5Br2NS/c9-5-1-4-2-7(10)12-8(4)6(11)3-5/h1-3H,11H2 |
| InChIKey | JIMFXOCRQBJJCC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.01 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|