C7H13ClO3 — CID 130870867
[(2R,3S,5R)-3-chloro-5-ethoxyoxolan-2-yl]methanol (PubChem CID 130870867) has the molecular formula C7H13ClO3 and a molecular weight of 180.63 g/mol. Its IUPAC name is [(2R,3S,5R)-3-chloro-5-ethoxyoxolan-2-yl]methanol.
| Compound Name | [(2R,3S,5R)-3-chloro-5-ethoxyoxolan-2-yl]methanol |
|---|---|
| PubChem CID | 130870867 |
| Molecular Formula | C7H13ClO3 |
| Molecular Weight | 180.63 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | [(2R,3S,5R)-3-chloro-5-ethoxyoxolan-2-yl]methanol |
| SMILES | CCO[C@H]1C[C@H](Cl)[C@@H](CO)O1 |
| InChI | InChI=1S/C7H13ClO3/c1-2-10-7-3-5(8)6(4-9)11-7/h5-7,9H,2-4H2,1H3/t5-,6+,7+/m0/s1 |
| InChIKey | JWIQRZDFECMYDO-RRKCRQDMSA-N |
| XLogP | 0.74 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.63 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|