C9H15NO3 — CID 130871125
4-methyl-7,10-dioxa-2-azaspiro[4.6]undecan-3-one (PubChem CID 130871125) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 4-methyl-7,10-dioxa-2-azaspiro[4.6]undecan-3-one.
| Compound Name | 4-methyl-7,10-dioxa-2-azaspiro[4.6]undecan-3-one |
|---|---|
| PubChem CID | 130871125 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 4-methyl-7,10-dioxa-2-azaspiro[4.6]undecan-3-one |
| SMILES | CC1C(=O)NCC12COCCOC2 |
| InChI | InChI=1S/C9H15NO3/c1-7-8(11)10-4-9(7)5-12-2-3-13-6-9/h7H,2-6H2,1H3,(H,10,11) |
| InChIKey | UMOBGZVREHDJTC-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |