C10H16ClNO2 — CID 130871596
2-chloro-1-(2,2-dimethyl-1,4-oxazepan-4-yl)prop-2-en-1-one (PubChem CID 130871596) has the molecular formula C10H16ClNO2 and a molecular weight of 217.70 g/mol. Its IUPAC name is 2-chloro-1-(2,2-dimethyl-1,4-oxazepan-4-yl)prop-2-en-1-one.
| Compound Name | 2-chloro-1-(2,2-dimethyl-1,4-oxazepan-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 130871596 |
| Molecular Formula | C10H16ClNO2 |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-chloro-1-(2,2-dimethyl-1,4-oxazepan-4-yl)prop-2-en-1-one |
| SMILES | C=C(Cl)C(=O)N1CCCOC(C)(C)C1 |
| InChI | InChI=1S/C10H16ClNO2/c1-8(11)9(13)12-5-4-6-14-10(2,3)7-12/h1,4-7H2,2-3H3 |
| InChIKey | GFFMZALCLXTSBJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|