C9H13N5 — CID 130892168
2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-ylmethylamino)acetonitrile (PubChem CID 130892168) has the molecular formula C9H13N5 and a molecular weight of 191.24 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-ylmethylamino)acetonitrile.
| Compound Name | 2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-ylmethylamino)acetonitrile |
|---|---|
| PubChem CID | 130892168 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-ylmethylamino)acetonitrile |
| SMILES | N#CCNCC1CCc2nncn2C1 |
| InChI | InChI=1S/C9H13N5/c10-3-4-11-5-8-1-2-9-13-12-7-14(9)6-8/h7-8,11H,1-2,4-6H2 |
| InChIKey | BPYYOISEKNPRAP-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|