C14H22N4O — CID 154759257
N-(cyclopentylmethyl)-N-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide (PubChem CID 154759257) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-N-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide.
| Compound Name | N-(cyclopentylmethyl)-N-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 154759257 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | N-(cyclopentylmethyl)-N-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
| SMILES | CN(CC1CCCC1)C(=O)C1CCc2nncn2C1 |
| InChI | InChI=1S/C14H22N4O/c1-17(8-11-4-2-3-5-11)14(19)12-6-7-13-16-15-10-18(13)9-12/h10-12H,2-9H2,1H3 |
| InChIKey | CNUWQPXSMPVDFA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |