C3H2Cl2I2 — CID 13089444
(E)-1,3-dichloro-1,2-diiodoprop-1-ene (PubChem CID 13089444) has the molecular formula C3H2Cl2I2 and a molecular weight of 362.76 g/mol. Its IUPAC name is (E)-1,3-dichloro-1,2-diiodoprop-1-ene.
| Compound Name | (E)-1,3-dichloro-1,2-diiodoprop-1-ene |
|---|---|
| PubChem CID | 13089444 |
| Molecular Formula | C3H2Cl2I2 |
| Molecular Weight | 362.76 g/mol |
| Exact Mass | 361.76 |
| IUPAC Name | (E)-1,3-dichloro-1,2-diiodoprop-1-ene |
| SMILES | ClC/C(I)=C(/Cl)I |
| InChI | InChI=1S/C3H2Cl2I2/c4-1-2(6)3(5)7/h1H2/b3-2+ |
| InChIKey | IMBYOJIODWIBJI-NSCUHMNNSA-N |
| XLogP | 3.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.76 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|