C7H5IN2O3S — CID 130895688
2-iodo-1,3-benzoxazole-4-sulfonamide (PubChem CID 130895688) has the molecular formula C7H5IN2O3S and a molecular weight of 324.10 g/mol. Its IUPAC name is 2-iodo-1,3-benzoxazole-4-sulfonamide.
| Compound Name | 2-iodo-1,3-benzoxazole-4-sulfonamide |
|---|---|
| PubChem CID | 130895688 |
| Molecular Formula | C7H5IN2O3S |
| Molecular Weight | 324.10 g/mol |
| Exact Mass | 323.91 |
| IUPAC Name | 2-iodo-1,3-benzoxazole-4-sulfonamide |
| SMILES | NS(=O)(=O)c1cccc2oc(I)nc12 |
| InChI | InChI=1S/C7H5IN2O3S/c8-7-10-6-4(13-7)2-1-3-5(6)14(9,11)12/h1-3H,(H2,9,11,12) |
| InChIKey | ZGINTPFECBRBCM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.10 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|