C8H6N2O4S — CID 131547174
2-formyl-1,3-benzoxazole-7-sulfonamide (PubChem CID 131547174) has the molecular formula C8H6N2O4S and a molecular weight of 226.21 g/mol. Its IUPAC name is 2-formyl-1,3-benzoxazole-7-sulfonamide.
| Compound Name | 2-formyl-1,3-benzoxazole-7-sulfonamide |
|---|---|
| PubChem CID | 131547174 |
| Molecular Formula | C8H6N2O4S |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 2-formyl-1,3-benzoxazole-7-sulfonamide |
| SMILES | NS(=O)(=O)c1cccc2nc(C=O)oc12 |
| InChI | InChI=1S/C8H6N2O4S/c9-15(12,13)6-3-1-2-5-8(6)14-7(4-11)10-5/h1-4H,(H2,9,12,13) |
| InChIKey | RYZHTEXKTZNHIR-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|