C13H18ClF — CID 130921221
1-(1-chloro-2-methylbutyl)-2-fluoro-4,5-dimethylbenzene (PubChem CID 130921221) has the molecular formula C13H18ClF and a molecular weight of 228.74 g/mol. Its IUPAC name is 1-(1-chloro-2-methylbutyl)-2-fluoro-4,5-dimethylbenzene.
| Compound Name | 1-(1-chloro-2-methylbutyl)-2-fluoro-4,5-dimethylbenzene |
|---|---|
| PubChem CID | 130921221 |
| Molecular Formula | C13H18ClF |
| Molecular Weight | 228.74 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 1-(1-chloro-2-methylbutyl)-2-fluoro-4,5-dimethylbenzene |
| SMILES | CCC(C)C(Cl)c1cc(C)c(C)cc1F |
| InChI | InChI=1S/C13H18ClF/c1-5-8(2)13(14)11-6-9(3)10(4)7-12(11)15/h6-8,13H,5H2,1-4H3 |
| InChIKey | RCUVKAQYDHXQGM-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.74 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|