C10H12O4 — CID 130921475
(1R,3aS,4R,7aS)-1-methyl-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylic acid (PubChem CID 130921475) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is (1R,3aS,4R,7aS)-1-methyl-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylic acid.
| Compound Name | (1R,3aS,4R,7aS)-1-methyl-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylic acid |
|---|---|
| PubChem CID | 130921475 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (1R,3aS,4R,7aS)-1-methyl-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylic acid |
| SMILES | C[C@H]1OC(=O)[C@H]2[C@@H]1C=CC[C@H]2C(=O)O |
| InChI | InChI=1S/C10H12O4/c1-5-6-3-2-4-7(9(11)12)8(6)10(13)14-5/h2-3,5-8H,4H2,1H3,(H,11,12)/t5-,6-,7-,8+/m1/s1 |
| InChIKey | HYBNULSEECDLTB-XUTVFYLZSA-N |
| XLogP | 0.82 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|