C10H14O — CID 130922997
(1R,5S)-4,5-dimethyl-3-methylidenebicyclo[3.2.0]heptan-6-one (PubChem CID 130922997) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is (1R,5S)-4,5-dimethyl-3-methylidenebicyclo[3.2.0]heptan-6-one.
| Compound Name | (1R,5S)-4,5-dimethyl-3-methylidenebicyclo[3.2.0]heptan-6-one |
|---|---|
| PubChem CID | 130922997 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (1R,5S)-4,5-dimethyl-3-methylidenebicyclo[3.2.0]heptan-6-one |
| SMILES | C=C1C[C@@H]2CC(=O)[C@]2(C)C1C |
| InChI | InChI=1S/C10H14O/c1-6-4-8-5-9(11)10(8,3)7(6)2/h7-8H,1,4-5H2,2-3H3/t7?,8-,10-/m1/s1 |
| InChIKey | JPQXIQGSEJVZNU-JDOFKEMOSA-N |
| XLogP | 2.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|