About isoquinoline-5-sulfinyl chloride
isoquinoline-5-sulfinyl chloride (PubChem CID 130933243) has the molecular formula C9H6ClNOS
and a molecular weight of 211.67 g/mol. Its IUPAC name is isoquinoline-5-sulfinyl chloride.
Molecular Properties
| Compound Name | isoquinoline-5-sulfinyl chloride |
| PubChem CID | 130933243 |
| Molecular Formula | C9H6ClNOS |
| Molecular Weight | 211.67 g/mol |
| Exact Mass | 210.99 |
| IUPAC Name | isoquinoline-5-sulfinyl chloride |
| SMILES | O=S(Cl)c1cccc2cnccc12 |
| InChI | InChI=1S/C9H6ClNOS/c10-13(12)9-3-1-2-7-6-11-5-4-8(7)9/h1-6H |
| InChIKey | BWSYAGJPPRPIRU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.67 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze isoquinoline-5-sulfinyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoquinoline-5-sulfinyl chloride?
The IUPAC name of isoquinoline-5-sulfinyl chloride (CID 130933243) is isoquinoline-5-sulfinyl chloride.
What is the SMILES notation for isoquinoline-5-sulfinyl chloride?
The canonical SMILES for isoquinoline-5-sulfinyl chloride is O=S(Cl)c1cccc2cnccc12.
What is the InChIKey of isoquinoline-5-sulfinyl chloride?
The InChIKey is BWSYAGJPPRPIRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNOS/c10-13(12)9-3-1-2-7-6-11-5-4-8(7)9/h1-6H.
What are the key properties of isoquinoline-5-sulfinyl chloride?
isoquinoline-5-sulfinyl chloride has a molecular weight of 211.67 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for isoquinoline-5-sulfinyl chloride is sourced from PubChem (CID 130933243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).