C9H20N2OS — CID 130933636
2,3-dimethyl-1-propylsulfinylpiperazine (PubChem CID 130933636) has the molecular formula C9H20N2OS and a molecular weight of 204.34 g/mol. Its IUPAC name is 2,3-dimethyl-1-propylsulfinylpiperazine.
| Compound Name | 2,3-dimethyl-1-propylsulfinylpiperazine |
|---|---|
| PubChem CID | 130933636 |
| Molecular Formula | C9H20N2OS |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2,3-dimethyl-1-propylsulfinylpiperazine |
| SMILES | CCCS(=O)N1CCNC(C)C1C |
| InChI | InChI=1S/C9H20N2OS/c1-4-7-13(12)11-6-5-10-8(2)9(11)3/h8-10H,4-7H2,1-3H3 |
| InChIKey | TUMMZSYKOKWBIQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |