C10H19N3O — CID 130933680
ethyl 1,5-diazabicyclo[3.2.2]nonane-6-carboximidate (PubChem CID 130933680) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is ethyl 1,5-diazabicyclo[3.2.2]nonane-6-carboximidate.
| Compound Name | ethyl 1,5-diazabicyclo[3.2.2]nonane-6-carboximidate |
|---|---|
| PubChem CID | 130933680 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | ethyl 1,5-diazabicyclo[3.2.2]nonane-6-carboximidate |
| SMILES | [H]/N=C(\OCC)C1CN2CCCN1CC2 |
| InChI | InChI=1S/C10H19N3O/c1-2-14-10(11)9-8-12-4-3-5-13(9)7-6-12/h9,11H,2-8H2,1H3/b11-10- |
| InChIKey | RPWQDZKBOOYBMC-KHPPLWFESA-N |
| XLogP | 0.39 |
| TPSA | 39.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|