C9H13ClN2OS — CID 130943461
6-chloro-4-(1,3-thiazol-5-ylmethyl)-1,4-oxazepane (PubChem CID 130943461) has the molecular formula C9H13ClN2OS and a molecular weight of 232.74 g/mol. Its IUPAC name is 6-chloro-4-(1,3-thiazol-5-ylmethyl)-1,4-oxazepane.
| Compound Name | 6-chloro-4-(1,3-thiazol-5-ylmethyl)-1,4-oxazepane |
|---|---|
| PubChem CID | 130943461 |
| Molecular Formula | C9H13ClN2OS |
| Molecular Weight | 232.74 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 6-chloro-4-(1,3-thiazol-5-ylmethyl)-1,4-oxazepane |
| SMILES | ClC1COCCN(Cc2cncs2)C1 |
| InChI | InChI=1S/C9H13ClN2OS/c10-8-4-12(1-2-13-6-8)5-9-3-11-7-14-9/h3,7-8H,1-2,4-6H2 |
| InChIKey | VLWHEIALCANMFK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.74 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|