About 6-chloro-4-(1,3-thiazol-5-ylmethyl)-1,4-oxazepane
6-chloro-4-(1,3-thiazol-5-ylmethyl)-1,4-oxazepane (PubChem CID 130943461) has the molecular formula C9H13ClN2OS
and a molecular weight of 232.74 g/mol. Its IUPAC name is 6-chloro-4-(1,3-thiazol-5-ylmethyl)-1,4-oxazepane.
Molecular Properties
| Compound Name | 6-chloro-4-(1,3-thiazol-5-ylmethyl)-1,4-oxazepane |
| PubChem CID | 130943461 |
| Molecular Formula | C9H13ClN2OS |
| Molecular Weight | 232.74 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 6-chloro-4-(1,3-thiazol-5-ylmethyl)-1,4-oxazepane |
| SMILES | ClC1COCCN(Cc2cncs2)C1 |
| InChI | InChI=1S/C9H13ClN2OS/c10-8-4-12(1-2-13-6-8)5-9-3-11-7-14-9/h3,7-8H,1-2,4-6H2 |
| InChIKey | VLWHEIALCANMFK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.74 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-4-(1,3-thiazol-5-ylmethyl)-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-(1,3-thiazol-5-ylmethyl)-1,4-oxazepane?
The IUPAC name of 6-chloro-4-(1,3-thiazol-5-ylmethyl)-1,4-oxazepane (CID 130943461) is 6-chloro-4-(1,3-thiazol-5-ylmethyl)-1,4-oxazepane.
What is the SMILES notation for 6-chloro-4-(1,3-thiazol-5-ylmethyl)-1,4-oxazepane?
The canonical SMILES for 6-chloro-4-(1,3-thiazol-5-ylmethyl)-1,4-oxazepane is ClC1COCCN(Cc2cncs2)C1.
What is the InChIKey of 6-chloro-4-(1,3-thiazol-5-ylmethyl)-1,4-oxazepane?
The InChIKey is VLWHEIALCANMFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClN2OS/c10-8-4-12(1-2-13-6-8)5-9-3-11-7-14-9/h3,7-8H,1-2,4-6H2.
What are the key properties of 6-chloro-4-(1,3-thiazol-5-ylmethyl)-1,4-oxazepane?
6-chloro-4-(1,3-thiazol-5-ylmethyl)-1,4-oxazepane has a molecular weight of 232.74 g/mol, XLogP of 1.58, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-(1,3-thiazol-5-ylmethyl)-1,4-oxazepane is sourced from PubChem (CID 130943461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).