C17H18O3 — CID 13094676
14-propan-2-ylidene-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-2(7)-ene-10,12-dione (PubChem CID 13094676) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 14-propan-2-ylidene-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-2(7)-ene-10,12-dione.
| Compound Name | 14-propan-2-ylidene-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-2(7)-ene-10,12-dione |
|---|---|
| PubChem CID | 13094676 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 14-propan-2-ylidene-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-2(7)-ene-10,12-dione |
| SMILES | CC(C)=C1C2C3=C(C4CCC3C4)C1C1C(=O)OC(=O)C21 |
| InChI | InChI=1S/C17H18O3/c1-6(2)9-12-10-7-3-4-8(5-7)11(10)13(9)15-14(12)16(18)20-17(15)19/h7-8,12-15H,3-5H2,1-2H3 |
| InChIKey | LYTGSSQGAGFBTP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|