C9H13N3O2 — CID 130963988
3-(2-aminooxyethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one (PubChem CID 130963988) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-(2-aminooxyethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one.
| Compound Name | 3-(2-aminooxyethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one |
|---|---|
| PubChem CID | 130963988 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 3-(2-aminooxyethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one |
| SMILES | NOCCn1cnc2c(c1=O)CCC2 |
| InChI | InChI=1S/C9H13N3O2/c10-14-5-4-12-6-11-8-3-1-2-7(8)9(12)13/h6H,1-5,10H2 |
| InChIKey | OORUYDXOZIQNAD-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|