C10H14N2O2 — CID 54589506
3-(2-hydroxyethyl)-5,6,7,8-tetrahydroquinazolin-4-one (PubChem CID 54589506) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-5,6,7,8-tetrahydroquinazolin-4-one.
| Compound Name | 3-(2-hydroxyethyl)-5,6,7,8-tetrahydroquinazolin-4-one |
|---|---|
| PubChem CID | 54589506 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 3-(2-hydroxyethyl)-5,6,7,8-tetrahydroquinazolin-4-one |
| SMILES | O=c1c2c(ncn1CCO)CCCC2 |
| InChI | InChI=1S/C10H14N2O2/c13-6-5-12-7-11-9-4-2-1-3-8(9)10(12)14/h7,13H,1-6H2 |
| InChIKey | XPRAQWJOFYWXMT-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |